diff --git a/src/blackgui/enableforframelesswindow.cpp b/src/blackgui/enableforframelesswindow.cpp
new file mode 100644
index 000000000..4f0127c2c
--- /dev/null
+++ b/src/blackgui/enableforframelesswindow.cpp
@@ -0,0 +1,116 @@
+/* Copyright (C) 2014
+ * swift project Community / Contributors
+ *
+ * This file is part of swift Project. It is subject to the license terms in the LICENSE file found in the top-level
+ * directory of this distribution and at http://www.swift-project.org/license.html. No part of swift project,
+ * including this file, may be copied, modified, propagated, or distributed except according to the terms
+ * contained in the LICENSE file.
+ */
+
+#include "enableforframelesswindow.h"
+#include "blackmisc/icons.h"
+#include <QSizeGrip>
+#include <QStatusBar>
+#include <QPushButton>
+
+using namespace BlackMisc;
+
+namespace BlackGui
+{
+
+    CEnableForFramelessWindow::CEnableForFramelessWindow(CEnableForFramelessWindow::WindowMode mode, bool isMainApplicationWindow, QWidget *correspondingWidget) :
+        m_windowMode(mode), m_mainApplicationWindow(isMainApplicationWindow), m_widget(correspondingWidget)
+    {
+        Q_ASSERT(correspondingWidget);
+        this->setWindowAttributes(mode);
+    }
+
+    void CEnableForFramelessWindow::setMode(CEnableForFramelessWindow::WindowMode mode)
+    {
+        if (mode == this->m_windowMode) { return; }
+        this->m_widget->setWindowFlags(modeToWindowFlags(mode));
+        this->setWindowAttributes(mode);
+        this->m_widget->show();
+        this->m_windowMode = mode;
+    }
+
+    void CEnableForFramelessWindow::setFrameless(bool frameless)
+    {
+        setMode(frameless ? WindowFrameless : WindowNormal);
+    }
+
+    void CEnableForFramelessWindow::setWindowAttributes(CEnableForFramelessWindow::WindowMode mode)
+    {
+        bool frameless = (mode == WindowFrameless);
+        // http://stackoverflow.com/questions/18316710/frameless-and-transparent-window-qt5
+        this->m_widget->setAttribute(Qt::WA_NoSystemBackground, frameless);
+        this->m_widget->setAttribute(Qt::WA_TranslucentBackground, frameless);
+        this->m_widget->setProperty("frameless", frameless);
+    }
+
+    bool CEnableForFramelessWindow::handleMouseMoveEvent(QMouseEvent *event)
+    {
+        Q_ASSERT(this->m_widget);
+        if (this->m_windowMode == WindowFrameless && event->buttons() & Qt::LeftButton)
+        {
+            this->m_widget->move(event->globalPos() - this->m_framelessDragPosition);
+            event->accept();
+            return true;
+        }
+        return false;
+    }
+
+    bool CEnableForFramelessWindow::handleMousePressEvent(QMouseEvent *event)
+    {
+        Q_ASSERT(this->m_widget);
+        if (this->m_windowMode == WindowFrameless && event->button() == Qt::LeftButton)
+        {
+            this->m_framelessDragPosition = event->globalPos() - this->m_widget->frameGeometry().topLeft();
+            event->accept();
+            return true;
+        }
+        return false;
+    }
+
+    void CEnableForFramelessWindow::addFramelessSizeGrip(QStatusBar *statusBar)
+    {
+        if (!statusBar) { return; }
+        QSizeGrip *grip = new QSizeGrip(this->m_widget);
+        grip->setObjectName("sg_FramelessSizeGrip");
+        statusBar->addPermanentWidget(grip);
+    }
+
+    QHBoxLayout *CEnableForFramelessWindow::addFramelessCloseButton(QMenuBar *menuBar)
+    {
+        Q_ASSERT(isFrameless());
+        Q_ASSERT(menuBar);
+        Q_ASSERT(this->m_widget);
+
+        if (!m_framelessCloseButton)
+        {
+            m_framelessCloseButton = new QPushButton(this->m_widget);
+            m_framelessCloseButton->setObjectName("pb_FramelessCloseButton");
+            m_framelessCloseButton->setIcon(CIcons::close16());
+            QObject::connect(m_framelessCloseButton, &QPushButton::clicked, this->m_widget, &QWidget::close);
+        }
+
+        QHBoxLayout *menuBarLayout = new QHBoxLayout;
+        menuBarLayout->setObjectName("hl_MenuBar");
+        menuBarLayout->addWidget(menuBar, 0, Qt::AlignTop | Qt::AlignLeft);
+        menuBarLayout->addWidget(m_framelessCloseButton, 0, Qt::AlignTop | Qt::AlignRight);
+        return menuBarLayout;
+    }
+
+    Qt::WindowFlags CEnableForFramelessWindow::modeToWindowFlags(CEnableForFramelessWindow::WindowMode mode)
+    {
+        switch (mode)
+        {
+        case WindowFrameless:
+            return (Qt::Window | Qt::FramelessWindowHint | Qt::WindowStaysOnTopHint);
+        case WindowNormal:
+        default:
+            return (Qt::Tool | Qt::WindowStaysOnTopHint | Qt::WindowMinimizeButtonHint | Qt::WindowCloseButtonHint);
+        }
+    }
+
+} // namespace
diff --git a/src/blackgui/enableforframelesswindow.h b/src/blackgui/enableforframelesswindow.h
new file mode 100644
index 000000000..8b00a795c
--- /dev/null
+++ b/src/blackgui/enableforframelesswindow.h
@@ -0,0 +1,85 @@
+/* Copyright (C) 2014
+ * swift project Community / Contributors
+ *
+ * This file is part of swift Project. It is subject to the license terms in the LICENSE file found in the top-level
+ * directory of this distribution and at http://www.swift-project.org/license.html. No part of swift project,
+ * including this file, may be copied, modified, propagated, or distributed except according to the terms
+ * contained in the LICENSE file.
+ */
+
+//! \file
+
+#ifndef BLACKGUI_ENABLEFORFRAMLESSWINDOW_H
+#define BLACKGUI_ENABLEFORFRAMLESSWINDOW_H
+
+#include <QWidget>
+#include <QStatusBar>
+#include <QMouseEvent>
+#include <QPushButton>
+#include <QHBoxLayout>
+#include <QMenuBar>
+
+namespace BlackGui
+{
+
+    //! Main window which can be frameless
+    //! \details QMainWindows cannot be promoted. Hence a derived class does not work properly here.
+    //!          Furthermore frameless functionality is also required for CDockWidgets as well.
+    class CEnableForFramelessWindow
+    {
+    public:
+        //! Window modes
+        enum WindowMode
+        {
+            WindowFrameless,
+            WindowNormal
+        };
+
+        //! Constructor
+        CEnableForFramelessWindow(WindowMode mode, bool isMainApplicationWindow, QWidget *correspondingWidget);
+
+        //! Window mode
+        void setMode(WindowMode mode);
+
+        //! Framless
+        void setFrameless(bool frameless);
+
+        //! Frameless?
+        bool isFrameless() const { return this->m_windowMode == WindowFrameless; }
+
+        //! The main application
+        bool isMainApplicationWindow() const { return m_mainApplicationWindow; }
+
+        //! Corresponding QMainWindow
+        QWidget *getWidget() const { return m_widget; }
+
+    protected:
+        //! Resize grip handle
+        void addFramelessSizeGrip(QStatusBar *statusBar);
+
+        //! Attributes
+        void setWindowAttributes(WindowMode mode);
+
+        //! Close button for frameless windows
+        QHBoxLayout *addFramelessCloseButton(QMenuBar *menuBar);
+
+        //! Translate mode
+        static Qt::WindowFlags modeToWindowFlags(WindowMode mode);
+
+        QPoint       m_framelessDragPosition;          //!< position, if moving is handled with frameless window */
+        QPushButton *m_framelessCloseButton = nullptr; //!< close button
+        WindowMode   m_windowMode = WindowNormal;      //!< Window mode, \sa WindowMode
+        bool         m_mainApplicationWindow = false;  //!< is the main application window (only 1)
+        QWidget     *m_widget = nullptr;               //!< corresponding main window or dock widget
+
+        //! Mouse press, required for frameless window
+        bool handleMousePressEvent(QMouseEvent *event);
+
+        //! Mouse moving, required for frameless window
+        bool handleMouseMoveEvent(QMouseEvent *event);
+
+    };
+
+} // namespace
+
+#endif // guard
diff --git a/src/blackgui/guiutility.cpp b/src/blackgui/guiutility.cpp
index b24145040..dfea51953 100644
--- a/src/blackgui/guiutility.cpp
+++ b/src/blackgui/guiutility.cpp
@@ -14,25 +14,23 @@
 namespace BlackGui
 {
 
-    QMainWindow *CGuiUtility::mainWindow()
+    CEnableForFramelessWindow *CGuiUtility::mainApplicationWindow()
     {
         QWidgetList tlw = topLevelApplicationWidgetsWithName();
         foreach(QWidget * w, tlw)
         {
-            QMainWindow *mw = qobject_cast<QMainWindow *>(w);
+            CEnableForFramelessWindow *mw = dynamic_cast<CEnableForFramelessWindow *>(w);
             if (!mw) { continue; }
-            QString n = mw->objectName().toLower();
-            if (n.contains("main") && n.contains("window")) return mw;
+            if (mw->isMainApplicationWindow()) return mw;
         }
         return nullptr;
     }
 
     bool CGuiUtility::isMainWindowFrameless()
     {
-        QMainWindow *mw = mainWindow();
+        CEnableForFramelessWindow *mw = mainApplicationWindow();
         Q_ASSERT(mw); // there should be a main window
-        if (!mw) return false;
-        return (mw->windowFlags() & Qt::FramelessWindowHint);
+        return (mw && mw->isFrameless());
     }
 
     QWidgetList CGuiUtility::topLevelApplicationWidgetsWithName()
@@ -41,7 +39,7 @@ namespace BlackGui
         QWidgetList rl;
         foreach(QWidget * w, tlw)
         {
-            if (w->objectName().isEmpty()) continue;
+            if (w->objectName().isEmpty()) { continue; }
             rl.append(w);
         }
         return rl;
@@ -49,8 +47,8 @@ namespace BlackGui
 
     QPoint CGuiUtility::mainWindowPosition()
     {
-        QMainWindow *mw = mainWindow();
-        return (mw) ? mw->pos() : QPoint();
+        CEnableForFramelessWindow *mw = mainApplicationWindow();
+        return (mw) ? mw->getWidget()->pos() : QPoint();
     }
 
     QPoint CGuiUtility::introWindowPosition()
@@ -59,7 +57,7 @@ namespace BlackGui
         foreach(QWidget * w, tlw)
         {
             QString n = w->objectName().toLower();
-            if (n.contains("intro")) return w->pos();
+            if (n.contains("intro")) { return w->pos(); }
         }
         return QPoint(0, 0);
     }
@@ -73,7 +71,7 @@ namespace BlackGui
     QString CGuiUtility::replaceTabCountValue(const QString &oldName, int count)
     {
         const QString v = QString("(").append(QString::number(count)).append(")");
-        if (oldName.isEmpty()) {return v; }
+        if (oldName.isEmpty()) { return v; }
         int index = oldName.lastIndexOf('(');
         if (index == 0) { return v; }
         if (index < 0) { return QString(oldName).append(" ").append(v); }
diff --git a/src/blackgui/guiutility.h b/src/blackgui/guiutility.h
index e5c768ae8..4a09d4691 100644
--- a/src/blackgui/guiutility.h
+++ b/src/blackgui/guiutility.h
@@ -13,7 +13,7 @@
 #define BLACKGUI_GUIUTILITY_H
 
 #include <QWidgetList>
-#include <QMainWindow>
+#include "enableforframelesswindow.h"
 
 namespace BlackGui
 {
@@ -24,7 +24,7 @@ namespace BlackGui
     public:
 
         //! Main application window
-        static QMainWindow *mainWindow();
+        static CEnableForFramelessWindow *mainApplicationWindow();
 
         //! Is main window frameless?
         static bool isMainWindowFrameless();
diff --git a/src/blackgui/infoarea.cpp b/src/blackgui/infoarea.cpp
index c774a6bdb..4fc1aa792 100644
--- a/src/blackgui/infoarea.cpp
+++ b/src/blackgui/infoarea.cpp
@@ -25,7 +25,8 @@ using namespace BlackMisc;
 
 namespace BlackGui
 {
-    CInfoArea::CInfoArea(QWidget *parent) : QMainWindow(parent)
+    CInfoArea::CInfoArea(QWidget *parent) :
+        QMainWindow(parent), CEnableForFramelessWindow(CEnableForFramelessWindow::WindowNormal, false, this)
     {
         this->ps_setInfoAreaFloating(this->m_infoAreaFloating);
         this->setWindowIcon(CIcons::swift24());
@@ -39,7 +40,7 @@ namespace BlackGui
         // after(!) GUI is setup
         if (this->m_dockWidgetInfoAreas.isEmpty())
         {
-            this->m_dockWidgetInfoAreas = this->initOwnDockWidgetInfoAreas();
+            this->m_dockWidgetInfoAreas = this->findOwnDockWidgetInfoAreas();
             Q_ASSERT(!this->m_dockWidgetInfoAreas.isEmpty());
         }
 
@@ -401,13 +402,19 @@ namespace BlackGui
             // this completely initializes the tab bar and all docked widgets
             if (init)
             {
+                // float
                 QPoint offset(i * 25, i * 20);
                 after->setVisible(false);
                 after->setFloating(true);
                 after->setOffsetWhenFloating(offset);
-                after->setPreferredSizeWhenFloating(this->getPreferredSizeWhenFloating(i));
+                QSize floatingSize = this->getPreferredSizeWhenFloating(i);
+                after->setPreferredSizeWhenFloating(floatingSize);
+
+                // dock again
                 after->setFloating(false);
                 after->setVisible(true);
+
+                // reset floating flag
                 after->resetWasAlreadyFLoating();
             }
             else
@@ -497,7 +504,7 @@ namespace BlackGui
         }
     }
 
-    QList<CDockWidgetInfoArea *> CInfoArea::initOwnDockWidgetInfoAreas()
+    QList<CDockWidgetInfoArea *> CInfoArea::findOwnDockWidgetInfoAreas() const
     {
         QList<CDockWidgetInfoArea *> infoAreas = this->findChildren<CDockWidgetInfoArea *>();
         if (infoAreas.isEmpty()) { return infoAreas; }
diff --git a/src/blackgui/infoarea.h b/src/blackgui/infoarea.h
index 83abad83b..fb2f62669 100644
--- a/src/blackgui/infoarea.h
+++ b/src/blackgui/infoarea.h
@@ -13,6 +13,7 @@
 #define BLACKGUI_INFOAREA_H
 
 #include "dockwidgetinfoarea.h"
+#include "enableforframelesswindow.h"
 #include <QMainWindow>
 #include <QTabBar>
 #include <QPixmap>
@@ -22,7 +23,7 @@ namespace BlackGui
 {
     //! Info area, hosting dockable widgets
     //! \sa CDockWidgetInfoArea
-    class CInfoArea : public QMainWindow
+    class CInfoArea : public QMainWindow, CEnableForFramelessWindow
     {
         Q_OBJECT
 
@@ -182,11 +183,11 @@ namespace BlackGui
         void setMarginsWhenDocked(int left, int top, int right, int bottom);
 
         //! Nested info areas
-        QList<CInfoArea *> getChildInfoAreas() { return this->findChildren<CInfoArea *>(); }
+        QList<CInfoArea *> getChildInfoAreas() const { return this->findChildren<CInfoArea *>(); }
 
         //! Direct dock widget areas, not the nested dock widget areas
         //! \remarks result stored in m_dockableWidgets
-        QList<CDockWidgetInfoArea *> initOwnDockWidgetInfoAreas();
+        QList<CDockWidgetInfoArea *> findOwnDockWidgetInfoAreas() const;
 
     private slots:
         //! Tab bar has been double clicked
diff --git a/src/blackgui/qss/mainwindow.qss b/src/blackgui/qss/mainwindow.qss
index c31e9520b..a5f61aaed 100644
--- a/src/blackgui/qss/mainwindow.qss
+++ b/src/blackgui/qss/mainwindow.qss
@@ -11,8 +11,8 @@ Used dynamic properties
 mainframeless (infobar.qss)
 **/
 
-/** putting background here works for framed, but not for frameless window **/
-#MainWindow {
+/** Main window **/
+QMainWindow {
   background-image: url(:/textures/icons/textures/texture-outer.jpg);
   background-color: darkslategray;
 }
diff --git a/src/swiftgui_standard/guimodeenums.h b/src/swiftgui_standard/guimodeenums.h
index f87300a12..51cdbab7c 100644
--- a/src/swiftgui_standard/guimodeenums.h
+++ b/src/swiftgui_standard/guimodeenums.h
@@ -7,21 +7,17 @@
  * contained in the LICENSE file.
  */
 
-#ifndef SAMPLE_GUIMODEENUMS_H
-#define SAMPLE_GUIMODEENUMS_H
+#ifndef STDGUI_GUIMODEENUMS_H
+#define STDGUI_GUIMODEENUMS_H
+
 
 //! Modes, how GUI can be started (core/GUI)
-struct GuiModes {
-
+struct GuiModes
+{
 public:
-    //! Window modes
-    enum WindowMode {
-        WindowFrameless,
-        WindowNormal
-    };
-
     //! Core runs how and where?
-    enum CoreMode {
+    enum CoreMode
+    {
         CoreInGuiProcess,
         CoreExternal,
         CoreExternalAudioLocal
diff --git a/src/swiftgui_standard/introwindow.cpp b/src/swiftgui_standard/introwindow.cpp
index 00c66e88f..dd2b339dd 100644
--- a/src/swiftgui_standard/introwindow.cpp
+++ b/src/swiftgui_standard/introwindow.cpp
@@ -33,12 +33,12 @@ CIntroWindow::~CIntroWindow() { }
 /*
  * Window mode
  */
-GuiModes::WindowMode CIntroWindow::getWindowMode() const
+BlackGui::CEnableForFramelessWindow::WindowMode CIntroWindow::getWindowMode() const
 {
     if (this->ui->rb_WindowFrameless->isChecked())
-        return GuiModes::WindowFrameless;
+        return BlackGui::CEnableForFramelessWindow::WindowFrameless;
     else
-        return GuiModes::WindowNormal;
+        return BlackGui::CEnableForFramelessWindow::WindowNormal;
 }
 
 /*
diff --git a/src/swiftgui_standard/introwindow.h b/src/swiftgui_standard/introwindow.h
index 98c7a9b82..e9125d5ea 100644
--- a/src/swiftgui_standard/introwindow.h
+++ b/src/swiftgui_standard/introwindow.h
@@ -9,10 +9,11 @@
 
 //! \file
 
-#ifndef SAMPLE_INTROWINDOW_H
-#define SAMPLE_INTROWINDOW_H
+#ifndef STDGUI_INTROWINDOW_H
+#define STDGUI_INTROWINDOW_H
 
 #include "guimodeenums.h"
+#include "blackgui/enableforframelesswindow.h"
 #include <QDialog>
 #include <QScopedPointer>
 
@@ -31,7 +32,7 @@ public:
     ~CIntroWindow();
 
     //! Selected window mode
-    GuiModes::WindowMode getWindowMode() const;
+    BlackGui::CEnableForFramelessWindow::WindowMode getWindowMode() const;
 
     //! Get core mode
     GuiModes::CoreMode getCoreMode() const;
diff --git a/src/swiftgui_standard/main.cpp b/src/swiftgui_standard/main.cpp
index 55a254355..6d8695ecc 100644
--- a/src/swiftgui_standard/main.cpp
+++ b/src/swiftgui_standard/main.cpp
@@ -15,6 +15,7 @@
 #include "blackcore/context_runtime_config.h"
 #include "blacksim/blacksimfreefunctions.h"
 #include "blackmisc/blackmiscfreefunctions.h"
+#include "blackmisc/logmessage.h"
 #include "blackmisc/icons.h"
 #include "blackmisc/loghandler.h"
 
@@ -24,6 +25,8 @@
 #include <QPushButton>
 
 using namespace BlackGui;
+using namespace BlackMisc;
+using namespace BlackCore;
 
 /*!
  * \brief Main
@@ -42,11 +45,11 @@ int main(int argc, char *argv[])
 
     // Translations
     QFile file(":blackmisc/translations/blackmisc_i18n_de.qm");
-    qDebug() << (file.exists() ? "Found translations in resources" : "No translations in resources");
+    CLogMessage("swift.standardgui.main").debug() << (file.exists() ? "Found translations in resources" : "No translations in resources");
     QTranslator translator;
     if (translator.load("blackmisc_i18n_de", ":blackmisc/translations/"))
     {
-        qDebug() << "Translator loaded";
+        CLogMessage("swift.standardgui.main").debug() << "Translator loaded";
     }
 
     // application
@@ -66,7 +69,7 @@ int main(int argc, char *argv[])
     a.setStyleSheet(s);
 
     // modes
-    GuiModes::WindowMode windowMode;
+    BlackGui::CMainWindow::WindowMode windowMode;
 
     // Dialog to decide external or internal core
     CIntroWindow intro;
diff --git a/src/swiftgui_standard/mainwindow.cpp b/src/swiftgui_standard/mainwindow.cpp
index edce55e31..8135297b1 100644
--- a/src/swiftgui_standard/mainwindow.cpp
+++ b/src/swiftgui_standard/mainwindow.cpp
@@ -38,23 +38,13 @@ using namespace BlackMisc::Hardware;
 /*
  * Constructor
  */
-MainWindow::MainWindow(GuiModes::WindowMode windowMode, QWidget *parent) :
-    QMainWindow(parent, windowMode == GuiModes::WindowFrameless ?
-                (Qt::Window | Qt::FramelessWindowHint | Qt::WindowStaysOnTopHint) :
-                (Qt::Tool | Qt::WindowStaysOnTopHint | Qt::WindowMinimizeButtonHint | Qt::WindowCloseButtonHint)),
-    ui(new Ui::MainWindow),
-    m_windowMode(windowMode)
+MainWindow::MainWindow(BlackGui::CMainWindow::WindowMode windowMode, QWidget *parent) :
+    BlackGui::CMainWindow(windowMode, parent),
+    ui(new Ui::MainWindow)
 {
-    if (windowMode == GuiModes::WindowFrameless)
-    {
-        // http://stackoverflow.com/questions/18316710/frameless-and-transparent-window-qt5
-        this->setAttribute(Qt::WA_NoSystemBackground, true);
-        this->setAttribute(Qt::WA_TranslucentBackground, true);
-        // this->setAttribute(Qt::WA_PaintOnScreen);
-    }
-
     // GUI
     ui->setupUi(this);
+    this->ui->wi_CentralWidgetOutside->setProperty("mainframeless", this->isFrameless());
     this->m_compInfoWindow = new CInfoWindowComponent(this); // setupUi has to be first!
 }
 
@@ -118,29 +108,6 @@ void MainWindow::closeEvent(QCloseEvent *event)
     QApplication::exit();
 }
 
-void MainWindow::mouseMoveEvent(QMouseEvent *event)
-{
-    // this->ui->fr_PseudoWindowBar->geometry().contains(event->pos())
-    if (this->m_windowMode == GuiModes::WindowFrameless && event->buttons() & Qt::LeftButton)
-    {
-        move(event->globalPos() - this->m_dragPosition);
-        event->accept();
-        return;
-    }
-    QWidget::mouseMoveEvent(event);
-}
-
-void MainWindow::mousePressEvent(QMouseEvent *event)
-{
-    if (this->m_windowMode == GuiModes::WindowFrameless && event->button() == Qt::LeftButton)
-    {
-        this->m_dragPosition = event->globalPos() - this->frameGeometry().topLeft();
-        event->accept();
-        return;
-    }
-    QWidget::mousePressEvent(event);
-}
-
 /*
  * Set main page
  */
diff --git a/src/swiftgui_standard/mainwindow.h b/src/swiftgui_standard/mainwindow.h
index 41850f093..79774e616 100644
--- a/src/swiftgui_standard/mainwindow.h
+++ b/src/swiftgui_standard/mainwindow.h
@@ -9,8 +9,8 @@
 
 //! \file
 
-#ifndef SAMPLE_MAINWINDOW_H
-#define SAMPLE_MAINWINDOW_H
+#ifndef STDGUI_SWIFTGUI_H
+#define STDGUI_SWIFTGUI_H
 
 // clash with struct interface in objbase.h used to happen
 #pragma push_macro("interface")
@@ -29,6 +29,7 @@
 #include "blackgui/models/userlistmodel.h"
 #include "blackgui/models/statusmessagelistmodel.h"
 #include "blackgui/models/keyboardkeylistmodel.h"
+#include "blackgui/mainwindow.h"
 #include "blackgui/managedstatusbar.h"
 #include "blackmisc/nwtextmessage.h"
 #include "blackmisc/loghandler.h"
@@ -44,7 +45,7 @@ namespace Ui { class MainWindow; }
 
 //! swift GUI
 class MainWindow :
-    public QMainWindow,
+    public BlackGui::CMainWindow,
     public BlackGui::Components::CEnableForRuntime
 {
     Q_OBJECT
@@ -60,7 +61,7 @@ public:
     };
 
     //! Constructor
-    explicit MainWindow(GuiModes::WindowMode windowMode, QWidget *parent = nullptr);
+    explicit MainWindow(BlackGui::CMainWindow::WindowMode windowMode, QWidget *parent = nullptr);
 
     //! Destructor
     ~MainWindow();
@@ -83,18 +84,11 @@ protected:
     //! Close event, e.g. when window is closed
     void closeEvent(QCloseEvent *event);
 
-    //! Mouse moving, required for frameless window
-    void mouseMoveEvent(QMouseEvent *event);
-
-    //! Mouse press, required for frameless window
-    void mousePressEvent(QMouseEvent *event);
-
 private:
     QScopedPointer<Ui::MainWindow> ui;
     bool m_init = false;
     BlackGui::Components::CInfoWindowComponent *m_compInfoWindow = nullptr; //!< the info window (popup
     BlackGui::CManagedStatusBar m_statusBar;
-    GuiModes::WindowMode        m_windowMode = GuiModes::WindowNormal;
     BlackInput::IKeyboard      *m_keyboard = nullptr; //!< hotkeys
     BlackMisc::CLogSubscriber   m_logSubscriber { this, &MainWindow::ps_displayStatusMessageInGui };
 
@@ -105,12 +99,6 @@ private:
     QTimer *m_timerContextWatchdog = nullptr;     //!< core available?
     BlackMisc::Aviation::CAircraft m_ownAircraft; //!< own aircraft's state
 
-    // frameless window
-    QPoint m_dragPosition; /*!< position, if moving is handled with frameless window */
-
-    // context menus
-    QMenu *m_contextMenuStatusMessageList = nullptr; /*!< context menu for status message list */
-
     // cockpit
     QString m_transponderResetValue;         //!< Temp. storage of XPdr mode to reset, req. until timer allows singleShoot with Lambdas
     QWidget *m_inputFocusedWidget = nullptr; //!< currently used widget for input, mainly used with cockpit
diff --git a/src/swiftgui_standard/mainwindow.ui b/src/swiftgui_standard/mainwindow.ui
index d3c1252b0..b0d1e7109 100644
--- a/src/swiftgui_standard/mainwindow.ui
+++ b/src/swiftgui_standard/mainwindow.ui
@@ -204,7 +204,7 @@
     </rect>
    </property>
    <property name="sizePolicy">
-    <sizepolicy hsizetype="Minimum" vsizetype="Minimum">
+    <sizepolicy hsizetype="Preferred" vsizetype="Preferred">
      <horstretch>0</horstretch>
      <verstretch>0</verstretch>
     </sizepolicy>
diff --git a/src/swiftgui_standard/mainwindow_init.cpp b/src/swiftgui_standard/mainwindow_init.cpp
index 0eb52ed04..86f2e921a 100644
--- a/src/swiftgui_standard/mainwindow_init.cpp
+++ b/src/swiftgui_standard/mainwindow_init.cpp
@@ -48,25 +48,17 @@ void MainWindow::init(const CRuntimeConfig &runtimeConfig)
 
     // with frameless window, we shift menu and statusbar into central widget
     // http://stackoverflow.com/questions/18316710/frameless-and-transparent-window-qt5
-    if (this->m_windowMode == GuiModes::WindowFrameless)
+    if (this->isFrameless())
     {
-        this->ui->wi_CentralWidgetOutside->setStyleSheet("#wi_CentralWidgetOutside {border: 2px solid green; border-radius: 20px; }");
-        this->ui->vl_CentralWidgetOutside->setContentsMargins(8, 8, 8, 8);
-
-        QHBoxLayout *menuBarLayout = new QHBoxLayout();
-        QPushButton *closeIcon = new QPushButton(this);
-        closeIcon->setStyleSheet("margin: 0; padding: 0; background: transparent;");
-        closeIcon->setIcon(CIcons::close16());
-        QObject::connect(closeIcon, &QPushButton::clicked, this, &QMainWindow::close);
-        menuBarLayout->addWidget(this->ui->mb_MainMenuBar, 0, Qt::AlignTop | Qt::AlignLeft);
-        menuBarLayout->addWidget(closeIcon, 0, Qt::AlignTop | Qt::AlignRight);
+        QHBoxLayout *menuBarLayout = this->addFramelessCloseButton(this->ui->mb_MainMenuBar);
         this->ui->vl_CentralWidgetOutside->insertLayout(0, menuBarLayout, 0);
 
-        QSizeGrip *grip = new QSizeGrip(this);
-        grip->setStyleSheet("margin-right: 25px; background-color: transparent;");
+        // move the status bar intothe frame (otherwise it is dangling outside)
         this->ui->sb_MainStatusBar->setParent(this->ui->wi_CentralWidgetOutside);
         this->ui->vl_CentralWidgetOutside->addWidget(this->ui->sb_MainStatusBar, 0);
-        this->ui->sb_MainStatusBar->addPermanentWidget(grip);
+
+        // grip
+        this->addFramelessSizeGrip(this->ui->sb_MainStatusBar);
     }
 
     // timers