refs #347, CMainWindow for frameless main windows

src/blackgui/enableforframelesswindow.cpp

@@ -0,0 +1,116 @@
+/* Copyright (C) 2014
+ * swift project Community / Contributors
+ *
+ * This file is part of swift Project. It is subject to the license terms in the LICENSE file found in the top-level
+ * directory of this distribution and at http://www.swift-project.org/license.html. No part of swift project,
+ * including this file, may be copied, modified, propagated, or distributed except according to the terms
+ * contained in the LICENSE file.
+ */
+
+#include "enableforframelesswindow.h"
+#include "blackmisc/icons.h"
+#include <QSizeGrip>
+#include <QStatusBar>
+#include <QPushButton>
+
+using namespace BlackMisc;
+
+namespace BlackGui
+{
+
+    CEnableForFramelessWindow::CEnableForFramelessWindow(CEnableForFramelessWindow::WindowMode mode, bool isMainApplicationWindow, QWidget *correspondingWidget) :
+        m_windowMode(mode), m_mainApplicationWindow(isMainApplicationWindow), m_widget(correspondingWidget)
+    {
+        Q_ASSERT(correspondingWidget);
+        this->setWindowAttributes(mode);
+    }
+
+    void CEnableForFramelessWindow::setMode(CEnableForFramelessWindow::WindowMode mode)
+    {
+        if (mode == this->m_windowMode) { return; }
+        this->m_widget->setWindowFlags(modeToWindowFlags(mode));
+        this->setWindowAttributes(mode);
+        this->m_widget->show();
+        this->m_windowMode = mode;
+    }
+
+    void CEnableForFramelessWindow::setFrameless(bool frameless)
+    {
+        setMode(frameless ? WindowFrameless : WindowNormal);
+    }
+
+    void CEnableForFramelessWindow::setWindowAttributes(CEnableForFramelessWindow::WindowMode mode)
+    {
+        bool frameless = (mode == WindowFrameless);
+        // http://stackoverflow.com/questions/18316710/frameless-and-transparent-window-qt5
+        this->m_widget->setAttribute(Qt::WA_NoSystemBackground, frameless);
+        this->m_widget->setAttribute(Qt::WA_TranslucentBackground, frameless);
+        this->m_widget->setProperty("frameless", frameless);
+    }
+
+    bool CEnableForFramelessWindow::handleMouseMoveEvent(QMouseEvent *event)
+    {
+        Q_ASSERT(this->m_widget);
+        if (this->m_windowMode == WindowFrameless && event->buttons() & Qt::LeftButton)
+        {
+            this->m_widget->move(event->globalPos() - this->m_framelessDragPosition);
+            event->accept();
+            return true;
+        }
+        return false;
+    }
+
+    bool CEnableForFramelessWindow::handleMousePressEvent(QMouseEvent *event)
+    {
+        Q_ASSERT(this->m_widget);
+        if (this->m_windowMode == WindowFrameless && event->button() == Qt::LeftButton)
+        {
+            this->m_framelessDragPosition = event->globalPos() - this->m_widget->frameGeometry().topLeft();
+            event->accept();
+            return true;
+        }
+        return false;
+    }
+
+    void CEnableForFramelessWindow::addFramelessSizeGrip(QStatusBar *statusBar)
+    {
+        if (!statusBar) { return; }
+        QSizeGrip *grip = new QSizeGrip(this->m_widget);
+        grip->setObjectName("sg_FramelessSizeGrip");
+        statusBar->addPermanentWidget(grip);
+    }
+
+    QHBoxLayout *CEnableForFramelessWindow::addFramelessCloseButton(QMenuBar *menuBar)
+    {
+        Q_ASSERT(isFrameless());
+        Q_ASSERT(menuBar);
+        Q_ASSERT(this->m_widget);
+
+        if (!m_framelessCloseButton)
+        {
+            m_framelessCloseButton = new QPushButton(this->m_widget);
+            m_framelessCloseButton->setObjectName("pb_FramelessCloseButton");
+            m_framelessCloseButton->setIcon(CIcons::close16());
+            QObject::connect(m_framelessCloseButton, &QPushButton::clicked, this->m_widget, &QWidget::close);
+        }
+
+        QHBoxLayout *menuBarLayout = new QHBoxLayout;
+        menuBarLayout->setObjectName("hl_MenuBar");
+        menuBarLayout->addWidget(menuBar, 0, Qt::AlignTop | Qt::AlignLeft);
+        menuBarLayout->addWidget(m_framelessCloseButton, 0, Qt::AlignTop | Qt::AlignRight);
+        return menuBarLayout;
+    }
+
+    Qt::WindowFlags CEnableForFramelessWindow::modeToWindowFlags(CEnableForFramelessWindow::WindowMode mode)
+    {
+        switch (mode)
+        {
+        case WindowFrameless:
+            return (Qt::Window | Qt::FramelessWindowHint | Qt::WindowStaysOnTopHint);
+        case WindowNormal:
+        default:
+            return (Qt::Tool | Qt::WindowStaysOnTopHint | Qt::WindowMinimizeButtonHint | Qt::WindowCloseButtonHint);
+        }
+    }
+
+} // namespace

src/blackgui/enableforframelesswindow.h

@@ -0,0 +1,85 @@
+/* Copyright (C) 2014
+ * swift project Community / Contributors
+ *
+ * This file is part of swift Project. It is subject to the license terms in the LICENSE file found in the top-level
+ * directory of this distribution and at http://www.swift-project.org/license.html. No part of swift project,
+ * including this file, may be copied, modified, propagated, or distributed except according to the terms
+ * contained in the LICENSE file.
+ */
+
+//! \file
+
+#ifndef BLACKGUI_ENABLEFORFRAMLESSWINDOW_H
+#define BLACKGUI_ENABLEFORFRAMLESSWINDOW_H
+
+#include <QWidget>
+#include <QStatusBar>
+#include <QMouseEvent>
+#include <QPushButton>
+#include <QHBoxLayout>
+#include <QMenuBar>
+
+namespace BlackGui
+{
+
+    //! Main window which can be frameless
+    //! \details QMainWindows cannot be promoted. Hence a derived class does not work properly here.
+    //!          Furthermore frameless functionality is also required for CDockWidgets as well.
+    class CEnableForFramelessWindow
+    {
+    public:
+        //! Window modes
+        enum WindowMode
+        {
+            WindowFrameless,
+            WindowNormal
+        };
+
+        //! Constructor
+        CEnableForFramelessWindow(WindowMode mode, bool isMainApplicationWindow, QWidget *correspondingWidget);
+
+        //! Window mode
+        void setMode(WindowMode mode);
+
+        //! Framless
+        void setFrameless(bool frameless);
+
+        //! Frameless?
+        bool isFrameless() const { return this->m_windowMode == WindowFrameless; }
+
+        //! The main application
+        bool isMainApplicationWindow() const { return m_mainApplicationWindow; }
+
+        //! Corresponding QMainWindow
+        QWidget *getWidget() const { return m_widget; }
+
+    protected:
+        //! Resize grip handle
+        void addFramelessSizeGrip(QStatusBar *statusBar);
+
+        //! Attributes
+        void setWindowAttributes(WindowMode mode);
+
+        //! Close button for frameless windows
+        QHBoxLayout *addFramelessCloseButton(QMenuBar *menuBar);
+
+        //! Translate mode
+        static Qt::WindowFlags modeToWindowFlags(WindowMode mode);
+
+        QPoint       m_framelessDragPosition;          //!< position, if moving is handled with frameless window */
+        QPushButton *m_framelessCloseButton = nullptr; //!< close button
+        WindowMode   m_windowMode = WindowNormal;      //!< Window mode, \sa WindowMode
+        bool         m_mainApplicationWindow = false;  //!< is the main application window (only 1)
+        QWidget     *m_widget = nullptr;               //!< corresponding main window or dock widget
+
+        //! Mouse press, required for frameless window
+        bool handleMousePressEvent(QMouseEvent *event);
+
+        //! Mouse moving, required for frameless window
+        bool handleMouseMoveEvent(QMouseEvent *event);
+
+    };
+
+} // namespace
+
+#endif // guard

src/blackgui/guiutility.cpp

@@ -14,25 +14,23 @@
 namespace BlackGui
 {
 
-    QMainWindow *CGuiUtility::mainWindow()
+    CEnableForFramelessWindow *CGuiUtility::mainApplicationWindow()
     {
         QWidgetList tlw = topLevelApplicationWidgetsWithName();
         foreach(QWidget * w, tlw)
         {
-            QMainWindow *mw = qobject_cast<QMainWindow *>(w);
+            CEnableForFramelessWindow *mw = dynamic_cast<CEnableForFramelessWindow *>(w);
             if (!mw) { continue; }
-            QString n = mw->objectName().toLower();
-            if (n.contains("main") && n.contains("window")) return mw;
+            if (mw->isMainApplicationWindow()) return mw;
         }
         return nullptr;
     }
 
     bool CGuiUtility::isMainWindowFrameless()
     {
-        QMainWindow *mw = mainWindow();
+        CEnableForFramelessWindow *mw = mainApplicationWindow();
         Q_ASSERT(mw); // there should be a main window
-        if (!mw) return false;
-        return (mw->windowFlags() & Qt::FramelessWindowHint);
+        return (mw && mw->isFrameless());
     }
 
     QWidgetList CGuiUtility::topLevelApplicationWidgetsWithName()
@@ -41,7 +39,7 @@ namespace BlackGui
         QWidgetList rl;
         foreach(QWidget * w, tlw)
         {
-            if (w->objectName().isEmpty()) continue;
+            if (w->objectName().isEmpty()) { continue; }
             rl.append(w);
         }
         return rl;
@@ -49,8 +47,8 @@ namespace BlackGui
 
     QPoint CGuiUtility::mainWindowPosition()
     {
-        QMainWindow *mw = mainWindow();
-        return (mw) ? mw->pos() : QPoint();
+        CEnableForFramelessWindow *mw = mainApplicationWindow();
+        return (mw) ? mw->getWidget()->pos() : QPoint();
     }
 
     QPoint CGuiUtility::introWindowPosition()
@@ -59,7 +57,7 @@ namespace BlackGui
         foreach(QWidget * w, tlw)
         {
             QString n = w->objectName().toLower();
-            if (n.contains("intro")) return w->pos();
+            if (n.contains("intro")) { return w->pos(); }
         }
         return QPoint(0, 0);
     }
@@ -73,7 +71,7 @@ namespace BlackGui
     QString CGuiUtility::replaceTabCountValue(const QString &oldName, int count)
     {
         const QString v = QString("(").append(QString::number(count)).append(")");
-        if (oldName.isEmpty()) {return v; }
+        if (oldName.isEmpty()) { return v; }
         int index = oldName.lastIndexOf('(');
         if (index == 0) { return v; }
         if (index < 0) { return QString(oldName).append(" ").append(v); }

src/blackgui/guiutility.h

@@ -13,7 +13,7 @@
 #define BLACKGUI_GUIUTILITY_H
 
 #include <QWidgetList>
-#include <QMainWindow>
+#include "enableforframelesswindow.h"
 
 namespace BlackGui
 {
@@ -24,7 +24,7 @@ namespace BlackGui
     public:
 
         //! Main application window
-        static QMainWindow *mainWindow();
+        static CEnableForFramelessWindow *mainApplicationWindow();
 
         //! Is main window frameless?
         static bool isMainWindowFrameless();

src/blackgui/infoarea.cpp

@@ -25,7 +25,8 @@ using namespace BlackMisc;
 
 namespace BlackGui
 {
-    CInfoArea::CInfoArea(QWidget *parent) : QMainWindow(parent)
+    CInfoArea::CInfoArea(QWidget *parent) :
+        QMainWindow(parent), CEnableForFramelessWindow(CEnableForFramelessWindow::WindowNormal, false, this)
     {
         this->ps_setInfoAreaFloating(this->m_infoAreaFloating);
         this->setWindowIcon(CIcons::swift24());
@@ -39,7 +40,7 @@ namespace BlackGui
         // after(!) GUI is setup
         if (this->m_dockWidgetInfoAreas.isEmpty())
         {
-            this->m_dockWidgetInfoAreas = this->initOwnDockWidgetInfoAreas();
+            this->m_dockWidgetInfoAreas = this->findOwnDockWidgetInfoAreas();
             Q_ASSERT(!this->m_dockWidgetInfoAreas.isEmpty());
         }
 
@@ -401,13 +402,19 @@ namespace BlackGui
             // this completely initializes the tab bar and all docked widgets
             if (init)
             {
+                // float
                 QPoint offset(i * 25, i * 20);
                 after->setVisible(false);
                 after->setFloating(true);
                 after->setOffsetWhenFloating(offset);
-                after->setPreferredSizeWhenFloating(this->getPreferredSizeWhenFloating(i));
+                QSize floatingSize = this->getPreferredSizeWhenFloating(i);
+                after->setPreferredSizeWhenFloating(floatingSize);
+
+                // dock again
                 after->setFloating(false);
                 after->setVisible(true);
+
+                // reset floating flag
                 after->resetWasAlreadyFLoating();
             }
             else
@@ -497,7 +504,7 @@ namespace BlackGui
         }
     }
 
-    QList<CDockWidgetInfoArea *> CInfoArea::initOwnDockWidgetInfoAreas()
+    QList<CDockWidgetInfoArea *> CInfoArea::findOwnDockWidgetInfoAreas() const
     {
         QList<CDockWidgetInfoArea *> infoAreas = this->findChildren<CDockWidgetInfoArea *>();
         if (infoAreas.isEmpty()) { return infoAreas; }

src/blackgui/infoarea.h

@@ -13,6 +13,7 @@
 #define BLACKGUI_INFOAREA_H
 
 #include "dockwidgetinfoarea.h"
+#include "enableforframelesswindow.h"
 #include <QMainWindow>
 #include <QTabBar>
 #include <QPixmap>
@@ -22,7 +23,7 @@ namespace BlackGui
 {
     //! Info area, hosting dockable widgets
     //! \sa CDockWidgetInfoArea
-    class CInfoArea : public QMainWindow
+    class CInfoArea : public QMainWindow, CEnableForFramelessWindow
     {
         Q_OBJECT
 
@@ -182,11 +183,11 @@ namespace BlackGui
         void setMarginsWhenDocked(int left, int top, int right, int bottom);
 
         //! Nested info areas
-        QList<CInfoArea *> getChildInfoAreas() { return this->findChildren<CInfoArea *>(); }
+        QList<CInfoArea *> getChildInfoAreas() const { return this->findChildren<CInfoArea *>(); }
 
         //! Direct dock widget areas, not the nested dock widget areas
         //! \remarks result stored in m_dockableWidgets
-        QList<CDockWidgetInfoArea *> initOwnDockWidgetInfoAreas();
+        QList<CDockWidgetInfoArea *> findOwnDockWidgetInfoAreas() const;
 
     private slots:
         //! Tab bar has been double clicked

src/blackgui/qss/mainwindow.qss

@@ -11,8 +11,8 @@ Used dynamic properties
 mainframeless (infobar.qss)
 **/
 
-/** putting background here works for framed, but not for frameless window **/
-#MainWindow {
+/** Main window **/
+QMainWindow {
   background-image: url(:/textures/icons/textures/texture-outer.jpg);
   background-color: darkslategray;
 }